Showing entry for Altanomalic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049268 |
| Compound Name | Altanomalic acid |
| Structure | ![]() |
| Formula | C15H18O5 |
| InchiKey | CCFUMNIQIIWCFN-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC(C(=C)C(=O)O)CC1=C(C)C(=O)CC1=O |
| Inchi | InChI=1S/C15H18O5/c1-8(16)4-5-11(9(2)15(19)20)6-12-10(3)13(17)7-14(12)18/h11H,2,4-7H2,1,3H3,(H,19,20) |
| IUPAC | 3-[(2-methyl-3,5-dioxocyclopenten-1-yl)methyl]-2-methylidene-6-oxoheptanoic acid |
| Molecular Weight | 278.12 |
| Pubchem Id | 44627913 |
| Chembl Id | CHEMBL1087762 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1087762 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
