Showing entry for Argenteanol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049299 |
| Compound Name | Argenteanol |
| Structure | ![]() |
| Formula | C30H50O4 |
| InchiKey | YAPWNPLDLBUZDW-XECJJSHOSA-N |
| SMILES | OC[C@@H]([C@H]1CC[C@@]2([C@]1(C)CC[C@@]13[C@H]2CC[C@@H]2[C@]3(C1)CC[C@@H](C2(C)C)O)C)[C@@H]([C@H](C=C(C)C)O)O |
| Inchi | InChI=1S/C30H50O4/c1-18(2)15-21(32)25(34)19(16-31)20-9-11-28(6)23-8-7-22-26(3,4)24(33)10-12-29(22)17-30(23,29)14-13-27(20,28)5/h15,19-25,31-34H,7-14,16-17H2,1-6H3/t19-,20+,21-,22-,23-,24-,25-,27+,28-,29+,30-/m0/s1 |
| IUPAC | |
| Molecular Weight | 474.37 |
| Pubchem Id | 71716958 |
| Chembl Id | CHEMBL2331819 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2331819 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
