Showing entry for Aristolactam Ii
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049491 |
| Compound Name | Aristolactam Ii |
| Structure | ![]() |
| Formula | C16H9NO3 |
| InchiKey | KPVDACWQNCRKTG-UHFFFAOYSA-N |
| SMILES | OC1=Nc2c3c1cc1OCOc1c3c1c(c2)cccc1 |
| Inchi | InChI=1S/C16H9NO3/c18-16-10-6-12-15(20-7-19-12)14-9-4-2-1-3-8(9)5-11(17-16)13(10)14/h1-6H,7H2,(H,17,18) |
| IUPAC | |
| Molecular Weight | 263.06 |
| Pubchem Id | 148745 |
| Chembl Id | CHEMBL603073 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50306868 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL603073 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
