Showing entry for 2,5-Imino-2,5,6-Trideoxy-D-Gulo-Heptitol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049579 |
| Compound Name | 2,5-Imino-2,5,6-Trideoxy-D-Gulo-Heptitol |
| Structure | ![]() |
| Formula | C7H15NO4 |
| InchiKey | AGFACLQFIYFFOI-BWBBJGPYSA-N |
| SMILES | OCC[C@H]1N[C@H]([C@@H]([C@H]1O)O)CO |
| Inchi | InChI=1S/C7H15NO4/c9-2-1-4-6(11)7(12)5(3-10)8-4/h4-12H,1-3H2/t4-,5+,6+,7+/m1/s1 |
| IUPAC | (2R,3S,4S,5S)-2-(2-hydroxyethyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| Molecular Weight | 177.1 |
| Pubchem Id | 44593591 |
| Chembl Id | CHEMBL464569 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50259958 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL464569 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
