Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049701 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C35H40O12 |
| InchiKey | ZZFJSWIPFJPKST-OCRATEHUSA-N |
| SMILES | CC(=O)OC[C@@]12[C@@H](OC(=O)c3ccccc3)C[C@@H]3[C@H]([C@]2(OC3(C)C)[C@@](C[C@@H]([C@@H]1OC(=O)C)OC(=O)c1ccccc1)(C)O)OC(=O)C |
| Inchi | InChI=1S/C35H40O12/c1-20(36)42-19-34-27(46-31(40)24-15-11-8-12-16-24)17-25-28(43-21(2)37)35(34,47-32(25,4)5)33(6,41)18-26(29(34)44-22(3)38)45-30(39)23-13-9-7-10-14-23/h7-16,25-29,41H,17-19H2,1-6H3/t25-,26+,27+,28-,29+,33+,34-,35+/m1/s1 |
| IUPAC | |
| Molecular Weight | 652.25 |
| Pubchem Id | 122177561 |
| Chembl Id | CHEMBL3577222 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3577222 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
