Showing entry for Gusanlungionoside C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049703 |
| Compound Name | Gusanlungionoside C |
| Structure | ![]() |
| Formula | C25H42O11 |
| InchiKey | ZUTSCUCRFVUYIA-XUGLSIFHSA-N |
| SMILES | OC[C@H]1O[C@@H](O[C@@H](CC[C@@H]2C(=CC(=O)CC2(C)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C25H42O11/c1-11-8-14(27)9-25(4,5)15(11)7-6-12(2)33-24-22(20(31)18(29)16(10-26)35-24)36-23-21(32)19(30)17(28)13(3)34-23/h8,12-13,15-24,26,28-32H,6-7,9-10H2,1-5H3/t12-,13+,15-,16-,17+,18-,19-,20+,21-,22-,23+,24-/m1/s1 |
| IUPAC | (4S)-4-[(3R)-3-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxybutyl]-3,5,5-trimethylcyclohex-2-en-1-one |
| Molecular Weight | 518.27 |
| Pubchem Id | 53355122 |
| Chembl Id | CHEMBL1813175 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50349819 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1813175 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
