Showing entry for 24-Methylene-5alpha-cycloarta-3beta,21-diol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049745 |
| Compound Name | 24-Methylene-5alpha-cycloarta-3beta,21-diol |
| Structure | ![]() |
| Formula | C31H52O2 |
| InchiKey | FJXNINQGUTYPNE-DLJSKDEVSA-N |
| SMILES | OC[C@@H]([C@H]1CC[C@@]2([C@]1(C)CC[C@@]13[C@H]2CC[C@@H]2[C@]3(C1)CC[C@@H](C2(C)C)O)C)CCC(=C)C(C)C |
| Inchi | InChI=1S/C31H52O2/c1-20(2)21(3)8-9-22(18-32)23-12-14-29(7)25-11-10-24-27(4,5)26(33)13-15-30(24)19-31(25,30)17-16-28(23,29)6/h20,22-26,32-33H,3,8-19H2,1-2,4-7H3/t22-,23+,24-,25-,26-,28+,29-,30+,31-/m0/s1 |
| IUPAC | |
| Molecular Weight | 456.4 |
| Pubchem Id | 71716352 |
| Chembl Id | CHEMBL2331820 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2331820 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
