Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049774 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C14H8Br6O3 |
| InchiKey | CNBWUPDUFTVCLE-UHFFFAOYSA-N |
| SMILES | COc1c(cc(cc1Br)Br)Oc1c(Br)c(Br)c(c(c1OC)Br)Br |
| Inchi | InChI=1S/C14H8Br6O3/c1-21-12-6(16)3-5(15)4-7(12)23-14-11(20)9(18)8(17)10(19)13(14)22-2/h3-4H,1-2H3 |
| IUPAC | 1,2,3,4-tetrabromo-5-(3,5-dibromo-2-methoxyphenoxy)-6-methoxybenzene |
| Molecular Weight | 697.56 |
| Pubchem Id | 23247448 |
| Chembl Id | CHEMBL148842 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL148842 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
