Showing entry for Licoarylcoumarin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0049875 |
| Compound Name | Licoarylcoumarin |
| Structure | ![]() |
| Formula | C21H20O6 |
| InchiKey | LCRIQVFKVCYUAO-UHFFFAOYSA-N |
| SMILES | C=CC(c1c(O)cc(c2c1oc(=O)c(c2)c1ccc(cc1O)O)OC)(C)C |
| Inchi | InChI=1S/C21H20O6/c1-5-21(2,3)18-16(24)10-17(26-4)14-9-13(20(25)27-19(14)18)12-7-6-11(22)8-15(12)23/h5-10,22-24H,1H2,2-4H3 |
| IUPAC | 3-(2,4-dihydroxyphenyl)-7-hydroxy-5-methoxy-8-(2-methylbut-3-en-2-yl)chromen-2-one |
| Molecular Weight | 368.13 |
| Pubchem Id | 10090416 |
| Chembl Id | CHEMBL3808458 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3808458 |
|
|||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
