Showing entry for Octisalate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0050037 |
| Compound Name | Octisalate |
| Structure | ![]() |
| Formula | C15H22O3 |
| InchiKey | FMRHJJZUHUTGKE-UHFFFAOYSA-N |
| SMILES | CCCCC(COC(=O)c1ccccc1O)CC |
| Inchi | InChI=1S/C15H22O3/c1-3-5-8-12(4-2)11-18-15(17)13-9-6-7-10-14(13)16/h6-7,9-10,12,16H,3-5,8,11H2,1-2H3 |
| IUPAC | 2-ethylhexyl 2-hydroxybenzoate |
| Molecular Weight | 250.16 |
| Pubchem Id | 8364 |
| Chembl Id | CHEMBL1329203 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1329203 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
