Showing entry for Osmundalactone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0050223 |
| Compound Name | Osmundalactone |
| Structure | ![]() |
| Formula | C6H8O3 |
| InchiKey | TVDPVFPVOHCHQM-UHNVWZDZSA-N |
| SMILES | C[C@H]1OC(=O)C=C[C@@H]1O |
| Inchi | InChI=1S/C6H8O3/c1-4-5(7)2-3-6(8)9-4/h2-5,7H,1H3/t4-,5+/m1/s1 |
| IUPAC | (2R,3S)-3-hydroxy-2-methyl-2,3-dihydropyran-6-one |
| Molecular Weight | 128.05 |
| Pubchem Id | 12374457 |
| Chembl Id | CHEMBL2040599 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2040599 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
