Showing entry for Combretic Acid B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0050482 |
| Compound Name | Combretic Acid B |
| Structure | ![]() |
| Formula | C32H50O6 |
| InchiKey | PYMOVAUYBLDWHR-OFMKDZFSSA-N |
| SMILES | CC(=O)O[C@H]1C[C@H]2[C@](C)(C(=O)O)[C@@H](O)CC[C@@]32[C@]2([C@@H]1[C@]1(C)CC[C@@H]([C@@]1(C)CC2)[C@@H](CC[C@@H](C(=C)C)O)C)C3 |
| Inchi | InChI=1S/C32H50O6/c1-18(2)22(34)9-8-19(3)21-10-12-29(6)26-23(38-20(4)33)16-24-30(7,27(36)37)25(35)11-13-31(24)17-32(26,31)15-14-28(21,29)5/h19,21-26,34-35H,1,8-17H2,2-7H3,(H,36,37)/t19-,21-,22+,23+,24+,25+,26+,28-,29+,30+,31-,32+/m1/s1 |
| IUPAC | |
| Molecular Weight | 530.36 |
| Pubchem Id | 51041528 |
| Chembl Id | CHEMBL1689267 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1689267 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
