Showing entry for (7R)-7-Hydroxylariciresinol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0050660 |
| Compound Name | (7R)-7-Hydroxylariciresinol |
| Structure | ![]() |
| Formula | C20H24O7 |
| InchiKey | MWQRAOGWLXTMIC-WZBLMQSHSA-N |
| SMILES | OC[C@@H]1[C@H](OC[C@@H]1[C@H](c1ccc(c(c1)OC)O)O)c1ccc(c(c1)OC)O |
| Inchi | InChI=1S/C20H24O7/c1-25-17-7-11(3-5-15(17)22)19(24)14-10-27-20(13(14)9-21)12-4-6-16(23)18(8-12)26-2/h3-8,13-14,19-24H,9-10H2,1-2H3/t13-,14-,19-,20+/m0/s1 |
| IUPAC | 4-[(2S,3R,4R)-4-[(R)-hydroxy-(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)oxolan-2-yl]-2-methoxyphenol |
| Molecular Weight | 376.15 |
| Pubchem Id | 10022393 |
| Chembl Id | CHEMBL1668112 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50335918 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1668112 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
