Showing entry for Curcumanolide D
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0050860 |
| Compound Name | Curcumanolide D |
| Structure | ![]() |
| Formula | C15H22O3 |
| InchiKey | PULYPMUFWFJDDV-ZETOZRRWSA-N |
| SMILES | O=C1O[C@@]2(C=C1C(O)(C)C)[C@H](C)CC[C@H]2C(=C)C |
| Inchi | InChI=1S/C15H22O3/c1-9(2)11-7-6-10(3)15(11)8-12(13(16)18-15)14(4,5)17/h8,10-11,17H,1,6-7H2,2-5H3/t10-,11+,15+/m1/s1 |
| IUPAC | (5R,6R,9S)-3-(2-hydroxypropan-2-yl)-6-methyl-9-prop-1-en-2-yl-1-oxaspiro[4.4]non-3-en-2-one |
| Molecular Weight | 250.16 |
| Pubchem Id | 71578720 |
| Chembl Id | CHEMBL2332424 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2332424 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
