Showing entry for Karakoline
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0051088 |
| Compound Name | Karakoline |
| Structure | ![]() |
| Formula | C22H35NO4 |
| InchiKey | HKQZUYOVMYOFIT-VEUUHKJVSA-N |
| SMILES | CCN1C[C@]2(C)CC[C@@H]([C@]34C1[C@H](C[C@H]23)[C@@]1(O)C[C@@H]([C@H]2C[C@@H]4[C@@H]1C2O)OC)O |
| Inchi | InChI=1S/C22H35NO4/c1-4-23-10-20(2)6-5-16(24)22-12-7-11-14(27-3)9-21(26,17(12)18(11)25)13(19(22)23)8-15(20)22/h11-19,24-26H,4-10H2,1-3H3/t11-,12-,13+,14+,15-,16+,17-,18?,19?,20+,21+,22-/m1/s1 |
| IUPAC | |
| Molecular Weight | 377.26 |
| Pubchem Id | 23986045 |
| Chembl Id | CHEMBL1872961 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1872961 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
