Showing entry for oxymatrine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0051149 |
| Compound Name | oxymatrine |
| Structure | ![]() |
| Formula | C15H24N2O2 |
| InchiKey | XVPBINOPNYFXID-LHDUFFHYSA-N |
| SMILES | O=C1CCC[C@H]2N1C[C@@H]1CCCN3(=O)[C@@H]1[C@@H]2CCC3 |
| Inchi | InChI=1S/C15H24N2O2/c18-14-7-1-6-13-12-5-3-9-17(19)8-2-4-11(15(12)17)10-16(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-,17?/m0/s1 |
| IUPAC | |
| Molecular Weight | 264.18 |
| Pubchem Id | 114850 |
| Chembl Id | CHEMBL458337 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL458337 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
