Showing entry for Sideroxylonal B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0051270 |
| Compound Name | Sideroxylonal B |
| Structure | ![]() |
| Formula | C26H28O10 |
| InchiKey | PHQDMQGEKNBIPF-GKZOTJLQSA-N |
| SMILES | O=Cc1c2O[C@H]([C@H]([C@@H](c2c(c(c1O)C=O)O)CC(C)C)C(C)C)c1c(O)c(C=O)c(c(c1O)C=O)O |
| Inchi | InChI=1S/C26H28O10/c1-10(2)5-12-17(11(3)4)26(19-23(34)13(6-27)20(31)14(7-28)24(19)35)36-25-16(9-30)21(32)15(8-29)22(33)18(12)25/h6-12,17,26,31-35H,5H2,1-4H3/t12-,17-,26+/m0/s1 |
| IUPAC | (2R,3S,4S)-2-(3,5-diformyl-2,4,6-trihydroxyphenyl)-5,7-dihydroxy-4-(2-methylpropyl)-3-propan-2-yl-3,4-dihydro-2H-chromene-6,8-dicarbaldehyde |
| Molecular Weight | 500.17 |
| Pubchem Id | 9848832 |
| Chembl Id | CHEMBL509880 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50241600 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL509880 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
