Showing entry for vobasine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0051322 |
| Compound Name | vobasine |
| Structure | ![]() |
| Formula | C21H24N2O3 |
| InchiKey | TYPMTMPLTVSOBU-VQTPNMTRSA-N |
| SMILES | COC(=O)[C@@H]1[C@@H]2Cc3c(C(=O)C[C@@H]1/C(=C\C)/CN2C)[nH]c1c3cccc1 |
| Inchi | InChI=1S/C21H24N2O3/c1-4-12-11-23(2)17-9-15-13-7-5-6-8-16(13)22-20(15)18(24)10-14(12)19(17)21(25)26-3/h4-8,14,17,19,22H,9-11H2,1-3H3/b12-4-/t14-,17+,19+/m1/s1 |
| IUPAC | |
| Molecular Weight | 352.18 |
| Pubchem Id | 26195301 |
| Chembl Id | CHEMBL1628271 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1628271 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
