Showing entry for 7-Demethoxyegonol-9(Z),12(Z)Linoleate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0051456 |
| Compound Name | 7-Demethoxyegonol-9(Z),12(Z)Linoleate |
| Structure | ![]() |
| Formula | C36H46O5 |
| InchiKey | AABHSZUTAUSICN-HZJYTTRNSA-N |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCCc1ccc2c(c1)cc(o2)c1ccc2c(c1)OCO2 |
| Inchi | InChI=1S/C36H46O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-36(37)38-24-17-18-29-20-22-32-31(25-29)27-34(41-32)30-21-23-33-35(26-30)40-28-39-33/h6-7,9-10,20-23,25-27H,2-5,8,11-19,24,28H2,1H3/b7-6-,10-9- |
| IUPAC | 3-[2-(1,3-benzodioxol-5-yl)-1-benzofuran-5-yl]propyl (9Z,12Z)-octadeca-9,12-dienoate |
| Molecular Weight | 558.33 |
| Pubchem Id | 56600472 |
| Chembl Id | CHEMBL1834807 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50355397 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1834807 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
