Showing entry for 8-oxocoptisine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0051552 |
| Compound Name | 8-oxocoptisine |
| Structure | ![]() |
| Formula | C19H13NO5 |
| InchiKey | UCAFJBSQKXVPDX-UHFFFAOYSA-N |
| SMILES | O=c1c2c(ccc3c2OCO3)cc2n1CCc1c2cc2c(c1)OCO2 |
| Inchi | InChI=1S/C19H13NO5/c21-19-17-11(1-2-14-18(17)25-9-22-14)5-13-12-7-16-15(23-8-24-16)6-10(12)3-4-20(13)19/h1-2,5-7H,3-4,8-9H2 |
| IUPAC | |
| Molecular Weight | 335.08 |
| Pubchem Id | 5245667 |
| Chembl Id | CHEMBL3612189 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50131223 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3612189 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
