Showing entry for (6R,8S,18R)-3,8,12,16-Tetramethyl-7,18-dioxa-tricyclo[13.3.0.0*6,8*]octadeca-2,11,15-triene
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0051599 |
| Compound Name | (6R,8S,18R)-3,8,12,16-Tetramethyl-7,18-dioxa-tricyclo[13.3.0.0*6,8*]octadeca-2,11,15-triene |
| Structure | ![]() |
| Formula | C20H30O2 |
| InchiKey | OQGXDKRHMBRZCS-PWFXJFPMSA-N |
| SMILES | C/C/1=C\CC[C@]2(C)O[C@@H]2CC/C(=C/[C@@H]2C(=C(C)CO2)CC1)/C |
| Inchi | InChI=1S/C20H30O2/c1-14-6-5-11-20(4)19(22-20)10-8-15(2)12-18-17(9-7-14)16(3)13-21-18/h6,12,18-19H,5,7-11,13H2,1-4H3/b14-6+,15-12+/t18-,19-,20+/m1/s1 |
| IUPAC | |
| Molecular Weight | 302.22 |
| Pubchem Id | 54585297 |
| Chembl Id | CHEMBL1761950 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50340947 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1761950 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
