Showing entry for Isoleucine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0051713 |
| Compound Name | Isoleucine |
| Structure | ![]() |
| Formula | C6H13NO2 |
| InchiKey | AGPKZVBTJJNPAG-UHNVWZDZSA-N |
| SMILES | CC[C@H]([C@@H](C(=O)O)N)C |
| Inchi | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5+/m1/s1 |
| IUPAC | (2S,3R)-2-azaniumyl-3-methylpentanoate |
| Molecular Weight | 131.09 |
| Pubchem Id | 99288 |
| Chembl Id | CHEMBL56053 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | IIL |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL56053 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
