Showing entry for [(8Bs)-4,8B-Dimethyl-3-(Methylcarbamoyl)-2,3A-Dihydro-1H-Pyrrolo[2,3-B]Indol-7-Yl] N-Methylcarbamate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0051844 |
| Compound Name | [(8Bs)-4,8B-Dimethyl-3-(Methylcarbamoyl)-2,3A-Dihydro-1H-Pyrrolo[2,3-B]Indol-7-Yl] N-Methylcarbamate |
| Structure | ![]() |
| Formula | C16H22N4O3 |
| InchiKey | PYEMNABYODPRPP-VYIIXAMBSA-N |
| SMILES | CN=C(Oc1ccc2c(c1)[C@]1(C)CCN(C1N2C)C(=NC)O)O |
| Inchi | InChI=1S/C16H22N4O3/c1-16-7-8-20(14(21)17-2)13(16)19(4)12-6-5-10(9-11(12)16)23-15(22)18-3/h5-6,9,13H,7-8H2,1-4H3,(H,17,21)(H,18,22)/t13?,16-/m0/s1 |
| IUPAC | [(8bS)-4,8b-dimethyl-3-(methylcarbamoyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-methylcarbamate |
| Molecular Weight | 318.17 |
| Pubchem Id | 3083935 |
| Chembl Id | CHEMBL77799 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50022773 |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL77799 |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
