Showing entry for jacaranone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0052040 |
| Compound Name | jacaranone |
| Structure | ![]() |
| Formula | C9H10O4 |
| InchiKey | WJZSKNRPRWCLLK-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1(O)C=CC(=O)C=C1 |
| Inchi | InChI=1S/C9H10O4/c1-13-8(11)6-9(12)4-2-7(10)3-5-9/h2-5,12H,6H2,1H3 |
| IUPAC | methyl 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
| Molecular Weight | 182.06 |
| Pubchem Id | 73307 |
| Chembl Id | CHEMBL469293 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL469293 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
