Showing entry for 4-ETHOXYBENZOIC ACID
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0052075 |
| Compound Name | 4-ETHOXYBENZOIC ACID |
| Structure | ![]() |
| Formula | C9H10O3 |
| InchiKey | SHSGDXCJYVZFTP-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(cc1)C(=O)O |
| Inchi | InChI=1S/C9H10O3/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| IUPAC | 4-ethoxybenzoic acid |
| Molecular Weight | 166.06 |
| Pubchem Id | 12093 |
| Chembl Id | CHEMBL324769 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | 81J |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL324769 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
