Showing entry for Corydaline
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0052290 |
| Compound Name | Corydaline |
| Structure | ![]() |
| Formula | C22H27NO4 |
| InchiKey | VRSRXLJTYQVOHC-ASSNKEHSSA-N |
| SMILES | COc1cc2CCN3[C@H](c2cc1OC)[C@H](C)c1c(C3)c(OC)c(cc1)OC |
| Inchi | InChI=1S/C22H27NO4/c1-13-15-6-7-18(24-2)22(27-5)17(15)12-23-9-8-14-10-19(25-3)20(26-4)11-16(14)21(13)23/h6-7,10-11,13,21H,8-9,12H2,1-5H3/t13-,21+/m1/s1 |
| IUPAC | (13R,13aS)-2,3,9,10-tetramethoxy-13-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
| Molecular Weight | 369.19 |
| Pubchem Id | 638256 |
| Chembl Id | CHEMBL4130319 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4130319 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
