Showing entry for Foliamangiferoside A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0052433 |
| Compound Name | Foliamangiferoside A |
| Structure | ![]() |
| Formula | C20H22O10 |
| InchiKey | XASGDINAKYXGSY-PQSJUMPYSA-N |
| SMILES | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(OC)cc(c(c1O)C(=O)c1ccc(cc1)O)O |
| Inchi | InChI=1S/C20H22O10/c1-29-11-6-10(23)13(15(24)8-2-4-9(22)5-3-8)17(26)14(11)20-19(28)18(27)16(25)12(7-21)30-20/h2-6,12,16,18-23,25-28H,7H2,1H3/t12-,16-,18+,19-,20+/m1/s1 |
| IUPAC | [2,6-dihydroxy-4-methoxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]-(4-hydroxyphenyl)methanone |
| Molecular Weight | 422.12 |
| Pubchem Id | 46206548 |
| Chembl Id | CHEMBL3233507 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3233507 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
