Showing entry for (+)-Phenazocine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0052475 |
| Compound Name | (+)-Phenazocine |
| Structure | ![]() |
| Formula | C22H27NO |
| InchiKey | ZQHYKVKNPWDQSL-XGRCMKMKSA-N |
| SMILES | Oc1ccc2c(c1)[C@@]1(C)CCN([C@@H](C2)[C@H]1C)CCc1ccccc1 |
| Inchi | InChI=1S/C22H27NO/c1-16-21-14-18-8-9-19(24)15-20(18)22(16,2)11-13-23(21)12-10-17-6-4-3-5-7-17/h3-9,15-16,21,24H,10-14H2,1-2H3/t16-,21+,22+/m1/s1 |
| IUPAC | |
| Molecular Weight | 321.21 |
| Pubchem Id | 3048356 |
| Chembl Id | CHEMBL94350 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL94350 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
