Showing entry for pericalline
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0052605 |
| Compound Name | pericalline |
| Structure | ![]() |
| Formula | C18H20N2 |
| InchiKey | YBWKMVPRGFJPHD-LELDJUSMSA-N |
| SMILES | C/C=C\1/CN2CC[C@H]1C(=C)c1c(C2)cc2c(c1)[nH]cc2 |
| Inchi | InChI=1S/C18H20N2/c1-3-13-10-20-7-5-16(13)12(2)17-9-18-14(4-6-19-18)8-15(17)11-20/h3-4,6,8-9,16,19H,2,5,7,10-11H2,1H3/b13-3-/t16-/m0/s1 |
| IUPAC | |
| Molecular Weight | 264.16 |
| Pubchem Id | 6436240 |
| Chembl Id | CHEMBL486306 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL486306 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
