Showing entry for cembrene A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0052815 |
| Compound Name | cembrene A |
| Structure | ![]() |
| Formula | C20H32 |
| InchiKey | VWSPQDDPRITBAM-KPGNMOGWSA-N |
| SMILES | C/C/1=C\C[C@@H](CC/C(=C/CC/C(=C/CC1)/C)/C)C(=C)C |
| Inchi | InChI=1S/C20H32/c1-16(2)20-14-12-18(4)10-6-8-17(3)9-7-11-19(5)13-15-20/h8,11-12,20H,1,6-7,9-10,13-15H2,2-5H3/b17-8+,18-12+,19-11+/t20-/m0/s1 |
| IUPAC | |
| Molecular Weight | 272.25 |
| Pubchem Id | 5281384 |
| Chembl Id | CHEMBL518765 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL518765 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
