Showing entry for Euphoractin F
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0053233 |
| Compound Name | Euphoractin F |
| Structure | ![]() |
| Formula | C27H36O6 |
| InchiKey | BINXIALJEOVUMZ-CASMLEBLSA-N |
| SMILES | C[C@H]1C[C@]2([C@H]([C@H]1OC(=O)c1ccccc1)[C@@H](O)[C@]1([C@](C2=O)(C)[C@H](O)[C@@H]2[C@H](CC1)C2(C)C)C)O |
| Inchi | InChI=1S/C27H36O6/c1-14-13-27(32)18(19(14)33-22(30)15-9-7-6-8-10-15)20(28)25(4)12-11-16-17(24(16,2)3)21(29)26(25,5)23(27)31/h6-10,14,16-21,28-29,32H,11-13H2,1-5H3/t14-,16-,17-,18+,19-,20+,21+,25-,26+,27+/m0/s1 |
| IUPAC | |
| Molecular Weight | 456.25 |
| Pubchem Id | 73351972 |
| Chembl Id | CHEMBL2385641 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2385641 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
