Showing entry for RHODOCLADONIC ACID
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0053314 |
| Compound Name | RHODOCLADONIC ACID |
| Structure | ![]() |
| Formula | C15H10O8 |
| InchiKey | UTQKMDZXMYCSCI-UHFFFAOYSA-N |
| SMILES | COC1=C(O)C(=O)c2c(C1=O)cc1oc(c(c1c2O)O)C(=O)C |
| Inchi | InChI=1S/C15H10O8/c1-4(16)14-12(20)8-6(23-14)3-5-7(10(8)18)11(19)13(21)15(22-2)9(5)17/h3,18,20-21H,1-2H3 |
| IUPAC | |
| Molecular Weight | 318.04 |
| Pubchem Id | 135403806 |
| Chembl Id | CHEMBL3039103 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3039103 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
