Showing entry for Acuminatin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0053757 |
| Compound Name | Acuminatin |
| Structure | ![]() |
| Formula | C21H24O4 |
| InchiKey | ITFKWUHXYCXXFF-XSOBDOKWSA-N |
| SMILES | C/C=C/c1cc(OC)c2c(c1)[C@@H](C)[C@@H](O2)c1ccc(c(c1)OC)OC |
| Inchi | InChI=1S/C21H24O4/c1-6-7-14-10-16-13(2)20(25-21(16)19(11-14)24-5)15-8-9-17(22-3)18(12-15)23-4/h6-13,20H,1-5H3/b7-6+/t13-,20-/m1/s1 |
| IUPAC | (2R,3R)-2-(3,4-dimethoxyphenyl)-7-methoxy-3-methyl-5-[(E)-prop-1-enyl]-2,3-dihydro-1-benzofuran |
| Molecular Weight | 340.17 |
| Pubchem Id | 6441048 |
| Chembl Id | CHEMBL571195 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50303154 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL571195 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
