Showing entry for Bakuchiol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0053762 |
| Compound Name | Bakuchiol |
| Structure | ![]() |
| Formula | C18H24O |
| InchiKey | LFYJSSARVMHQJB-QIXNEVBVSA-N |
| SMILES | C=C[C@@](/C=C/c1ccc(cc1)O)(CCC=C(C)C)C |
| Inchi | InChI=1S/C18H24O/c1-5-18(4,13-6-7-15(2)3)14-12-16-8-10-17(19)11-9-16/h5,7-12,14,19H,1,6,13H2,2-4H3/b14-12+/t18-/m1/s1 |
| IUPAC | 4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol |
| Molecular Weight | 256.18 |
| Pubchem Id | 5468522 |
| Chembl Id | CHEMBL262344 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL262344 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
