Showing entry for Mahkoside A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0053818 |
| Compound Name | Mahkoside A |
| Structure | ![]() |
| Formula | C20H22O10 |
| InchiKey | LCZPALDWQFYTCU-LWUBGYQZSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2cc(OC)cc(c2C(=O)c2ccc(cc2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C20H22O10/c1-28-11-6-12(23)15(16(24)9-2-4-10(22)5-3-9)13(7-11)29-20-19(27)18(26)17(25)14(8-21)30-20/h2-7,14,17-23,25-27H,8H2,1H3/t14-,17-,18+,19-,20-/m1/s1 |
| IUPAC | |
| Molecular Weight | 422.12 |
| Pubchem Id | 71451475 |
| Chembl Id | CHEMBL2159665 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2159665 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
