Showing entry for Glycylglycylglycine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0000253 |
| Compound Name | Glycylglycylglycine |
| Structure | ![]() |
| Formula | C6H11N3O4 |
| InchiKey | XKUKSGPZAADMRA-UHFFFAOYSA-N |
| SMILES | NC\C(O)=N\C\C(O)=N\CC(O)=O |
| Inchi | InChI=1S/C6H11N3O4/c7-1-4(10)8-2-5(11)9-3-6(12)13/h1-3,7H2,(H,8,10)(H,9,11)(H,12,13) |
| IUPAC | 2-[(Z)-{2-[(Z)-(2-amino-1-hydroxyethylidene)amino]-1-hydroxyethylidene}amino]acetic acid |
| Molecular Weight | 189.17 |
| Pubchem Id | 11161 |
| Chembl Id | CHEMBL54278 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | GGG |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50188484 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL54278 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
