Showing entry for Kuwanon A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0000347 |
| Compound Name | Kuwanon A |
| Structure | ![]() |
| Formula | C25H24O6 |
| InchiKey | DBUNRZUFILGKHP-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC1=C(OC2=CC(O)=CC(O)=C2C1=O)C1=C2OC(C)(C)C=CC2=C(O)C=C1 |
| Inchi | InChI=1S/C25H24O6/c1-13(2)5-6-16-22(29)21-19(28)11-14(26)12-20(21)30-23(16)17-7-8-18(27)15-9-10-25(3,4)31-24(15)17/h5,7-12,26-28H,6H2,1-4H3 |
| IUPAC | 5,7-dihydroxy-2-(5-hydroxy-2,2-dimethyl-2H-chromen-8-yl)-3-(3-methylbut-2-en-1-yl)-4H-chromen-4-one |
| Molecular Weight | 420.45 |
| Pubchem Id | 44258296 |
| Chembl Id | CHEMBL1770312 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1770312 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
