Showing entry for Chiro-Inositol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0000709 |
| Compound Name | Chiro-Inositol |
| Structure | ![]() |
| Formula | C6H12O6 |
| InchiKey | CDAISMWEOUEBRE-LKPKBOIGSA-N |
| SMILES | O[C@H]1[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| Inchi | InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4-,5+,6+/m0/s1 |
| IUPAC | (1R,2R,3R,4R,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol |
| Molecular Weight | 180.16 |
| Pubchem Id | |
| Chembl Id | CHEMBL1231671 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | CBU |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1231671 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
