Showing entry for 5-O-Methylgenistein
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0001123 |
| Compound Name | 5-O-Methylgenistein |
| Structure | ![]() |
| Formula | C16H12O5 |
| InchiKey | YSINCDVRUMTOPK-UHFFFAOYSA-N |
| SMILES | COC1=CC(O)=CC2=C1C(=O)C(=CO2)C1=CC=C(O)C=C1 |
| Inchi | InChI=1S/C16H12O5/c1-20-13-6-11(18)7-14-15(13)16(19)12(8-21-14)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| IUPAC | 7-hydroxy-3-(4-hydroxyphenyl)-5-methoxy-4H-chromen-4-one |
| Molecular Weight | 284.26 |
| Pubchem Id | 5748551 |
| Chembl Id | CHEMBL1479463 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1479463 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
