Showing entry for L-2-Amino-3-(4-aminophenyl)propanoic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0001625 |
| Compound Name | L-2-Amino-3-(4-aminophenyl)propanoic acid |
| Structure | ![]() |
| Formula | C9H12N2O2 |
| InchiKey | CMUHFUGDYMFHEI-UHFFFAOYSA-N |
| SMILES | NC(CC1=CC=C(N)C=C1)C(O)=O |
| Inchi | InChI=1S/C9H12N2O2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,10-11H2,(H,12,13) |
| IUPAC | 2-amino-3-(4-aminophenyl)propanoic acid |
| Molecular Weight | 180.2 |
| Pubchem Id | 95174 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 36558 |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
