Showing entry for Pinocembrin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0002037 |
| Compound Name | Pinocembrin |
| Structure | ![]() |
| Formula | C15H12O4 |
| InchiKey | URFCJEUYXNAHFI-UHFFFAOYSA-N |
| SMILES | OC1=CC(O)=C2C(=O)CC(OC2=C1)C1=CC=CC=C1 |
| Inchi | InChI=1S/C15H12O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-7,13,16-17H,8H2 |
| IUPAC | 5,7-dihydroxy-2-phenyl-3,4-dihydro-2H-1-benzopyran-4-one |
| Molecular Weight | 256.26 |
| Pubchem Id | 238782 |
| Chembl Id | CHEMBL70518 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 243060 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL70518 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
