Showing entry for Byakangelicol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0003227 |
| Compound Name | Byakangelicol |
| Structure | ![]() |
| Formula | C17H16O6 |
| InchiKey | ORBITTMJKIGFNH-LLVKDONJSA-N |
| SMILES | COC1=C2C=COC2=C(OC[C@H]2OC2(C)C)C2=C1C=CC(=O)O2 |
| Inchi | InChI=1S/C17H16O6/c1-17(2)11(23-17)8-21-16-14-10(6-7-20-14)13(19-3)9-4-5-12(18)22-15(9)16/h4-7,11H,8H2,1-3H3/t11-/m1/s1 |
| IUPAC | 9-{[(2R)-3,3-dimethyloxiran-2-yl]methoxy}-4-methoxy-7H-furo[3,2-g]chromen-7-one |
| Molecular Weight | 316.31 |
| Pubchem Id | 3055167 |
| Chembl Id | CHEMBL1934196 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||
| Binding DB | 50361389 |
|
|||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1934196 |
|
|||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
