Showing entry for Dihydroisorhamnetin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0008894 |
| Compound Name | Dihydroisorhamnetin |
| Structure | ![]() |
| Formula | C16H14O7 |
| InchiKey | JWYULKXTGMJKKM-UHFFFAOYSA-N |
| SMILES | COC1=C(O)C=CC(=C1)C1OC2=CC(O)=CC(O)=C2C(=O)C1O |
| Inchi | InChI=1S/C16H14O7/c1-22-11-4-7(2-3-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,15-19,21H,1H3 |
| IUPAC | 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,4-dihydro-2H-1-benzopyran-4-one |
| Molecular Weight | 318.28 |
| Pubchem Id | 56658060 |
| Chembl Id | CHEMBL1822704 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1822704 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
