Showing entry for Eduleine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0008969 |
| Compound Name | Eduleine |
| Structure | ![]() |
| Formula | C17H15NO2 |
| InchiKey | SNNYHVVKJUPXKZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C=C(N2C)C1=CC=CC=C1 |
| Inchi | InChI=1S/C17H15NO2/c1-18-15(12-6-4-3-5-7-12)11-17(19)14-9-8-13(20-2)10-16(14)18/h3-11H,1-2H3 |
| IUPAC | 7-methoxy-1-methyl-2-phenyl-1,4-dihydroquinolin-4-one |
| Molecular Weight | 265.31 |
| Pubchem Id | 253834 |
| Chembl Id | CHEMBL1721520 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 32704 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1721520 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
