Showing entry for Lupiwighteone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0010053 |
| Compound Name | Lupiwighteone |
| Structure | ![]() |
| Formula | C20H18O5 |
| InchiKey | YGCCASGFIOIXIN-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC1=C2OC=C(C(=O)C2=C(O)C=C1O)C1=CC=C(O)C=C1 |
| Inchi | InChI=1S/C20H18O5/c1-11(2)3-8-14-16(22)9-17(23)18-19(24)15(10-25-20(14)18)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
| IUPAC | 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-(3-methylbut-2-en-1-yl)-4H-chromen-4-one |
| Molecular Weight | 338.35 |
| Pubchem Id | 5317480 |
| Chembl Id | CHEMBL3616491 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3616491 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
