Showing entry for 1,7-Dihydroxy-3,6-dimethoxy-2,8-diprenylxanthone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0011964 |
| Compound Name | 1,7-Dihydroxy-3,6-dimethoxy-2,8-diprenylxanthone |
| Structure | ![]() |
| Formula | C25H28O6 |
| InchiKey | WDOPYKHYPKRXRJ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(O)=C1CC=C(C)C)C(=O)C1=C(CC=C(C)C)C(O)=C(OC)C=C1O2 |
| Inchi | InChI=1S/C25H28O6/c1-13(2)7-9-15-17(29-5)11-19-22(24(15)27)25(28)21-16(10-8-14(3)4)23(26)20(30-6)12-18(21)31-19/h7-8,11-12,26-27H,9-10H2,1-6H3 |
| IUPAC | 1,7-dihydroxy-3,6-dimethoxy-2,8-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Molecular Weight | 424.49 |
| Pubchem Id | 14777483 |
| Chembl Id | CHEMBL3421823 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3421823 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
