Showing entry for Dibromoacetic Acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0012704 |
| Compound Name | Dibromoacetic Acid |
| Structure | ![]() |
| Formula | C2H2Br2O2 |
| InchiKey | SIEILFNCEFEENQ-UHFFFAOYSA-N |
| SMILES | BrC(C(=O)O)Br |
| Inchi | InChI=1S/C2H2Br2O2/c3-1(4)2(5)6/h1H,(H,5,6) |
| IUPAC | 2,2-dibromoacetic acid |
| Molecular Weight | 215.84 |
| Pubchem Id | 12433 |
| Chembl Id | CHEMBL449362 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL449362 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
