Showing entry for L-Sulforaphane
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013012 |
| Compound Name | L-Sulforaphane |
| Structure | ![]() |
| Formula | C6H11NOS2 |
| InchiKey | SUVMJBTUFCVSAD-JTQLQIEISA-N |
| SMILES | S=C=NCCCC[S@@](=O)C |
| Inchi | InChI=1S/C6H11NOS2/c1-10(8)5-3-2-4-7-6-9/h2-5H2,1H3/t10-/m0/s1 |
| IUPAC | 1-isothiocyanato-4-[(S)-methylsulfinyl]butane |
| Molecular Weight | 177.03 |
| Pubchem Id | 10419733 |
| Chembl Id | CHEMBL1627201 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1627201 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
