Showing entry for 1,3-Dibenzylurea
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013475 |
| Compound Name | 1,3-Dibenzylurea |
| Structure | ![]() |
| Formula | C15H16N2O |
| InchiKey | KATOLVAXCGIBLO-UHFFFAOYSA-N |
| SMILES | OC(=NCc1ccccc1)NCc1ccccc1 |
| Inchi | InChI=1S/C15H16N2O/c18-15(16-11-13-7-3-1-4-8-13)17-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H2,16,17,18) |
| IUPAC | 1,3-dibenzylurea |
| Molecular Weight | 240.13 |
| Pubchem Id | 72889 |
| Chembl Id | CHEMBL504463 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50248768 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL504463 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
