Showing entry for Lauterine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0013476 |
| Compound Name | Lauterine |
| Structure | ![]() |
| Formula | C18H11NO4 |
| InchiKey | BHFUORVSBHCRKK-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)c1c3OCOc3cc3c1c(C2=O)ncc3 |
| Inchi | InChI=1S/C18H11NO4/c1-21-10-2-3-11-12(7-10)15-14-9(4-5-19-16(14)17(11)20)6-13-18(15)23-8-22-13/h2-7H,8H2,1H3 |
| IUPAC | |
| Molecular Weight | 305.07 |
| Pubchem Id | 73104 |
| Chembl Id | CHEMBL471281 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL471281 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
